![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| CI-Simple-Periodic-Table-of-the-Elements-2017-1024x724.png | 03-Feb-2018 18:03 | 380K | |
| Chemical Analysis Problems.docx | 03-Feb-2018 18:03 | 80K | |
| Overview of session.docx | 03-Feb-2018 18:03 | 12K | |
| Periodic table.jpg | 03-Feb-2018 18:03 | 377K | |
| Problem Sets 1 - 5.docx | 03-Feb-2018 18:03 | 223K | |
| Sat Workshop Feb 2018.pdf | 03-Feb-2018 18:03 | 1.5M | |
| Sat Workshop Feb 2018.pptx | 03-Feb-2018 18:03 | 1.1M | |
| Solutions to concentration calculations.docx | 03-Feb-2018 18:03 | 115K | |